C17H16BrN3O6S — CID 4124163
N-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]ethyl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 4124163) has the molecular formula C17H16BrN3O6S and a molecular weight of 470.30 g/mol. Its IUPAC name is N-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]ethyl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]ethyl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4124163 |
| Molecular Formula | C17H16BrN3O6S |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | N-[2-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]ethyl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C/c2cc3c(cc2Br)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16BrN3O6S/c1-11-2-3-13(7-15(11)21(22)23)28(24,25)20-5-4-19-9-12-6-16-17(8-14(12)18)27-10-26-16/h2-3,6-9,20H,4-5,10H2,1H3/b19-9+ |
| InChIKey | OTIMKLBOKXRAJH-DJKKODMXSA-N |
| XLogP | 2.79 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|