C15H9Br2NO7 — CID 158841753
6-bromo-1,3-benzodioxole-5-carbaldehyde;5-bromo-6-nitro-1,3-benzodioxole (PubChem CID 158841753) has the molecular formula C15H9Br2NO7 and a molecular weight of 475.05 g/mol. Its IUPAC name is 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-bromo-6-nitro-1,3-benzodioxole.
| Compound Name | 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-bromo-6-nitro-1,3-benzodioxole |
|---|---|
| PubChem CID | 158841753 |
| Molecular Formula | C15H9Br2NO7 |
| Molecular Weight | 475.05 g/mol |
| Exact Mass | 472.87 |
| IUPAC Name | 6-bromo-1,3-benzodioxole-5-carbaldehyde;5-bromo-6-nitro-1,3-benzodioxole |
| SMILES | O=Cc1cc2c(cc1Br)OCO2.O=[N+]([O-])c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H5BrO3.C7H4BrNO4/c9-6-2-8-7(11-4-12-8)1-5(6)3-10;8-4-1-6-7(13-3-12-6)2-5(4)9(10)11/h1-3H,4H2;1-2H,3H2 |
| InChIKey | IYIHQYPGGZGBNA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.05 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|