C15H11BrN2O4 — CID 1079446
N-(2-bromo-4-methylphenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine (PubChem CID 1079446) has the molecular formula C15H11BrN2O4 and a molecular weight of 363.17 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-(2-bromo-4-methylphenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 1079446 |
| Molecular Formula | C15H11BrN2O4 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
| SMILES | Cc1ccc(/N=C/c2cc3c(cc2[N+](=O)[O-])OCO3)c(Br)c1 |
| InChI | InChI=1S/C15H11BrN2O4/c1-9-2-3-12(11(16)4-9)17-7-10-5-14-15(22-8-21-14)6-13(10)18(19)20/h2-7H,8H2,1H3/b17-7+ |
| InChIKey | IUGTUBYMXNMICX-REZTVBANSA-N |
| XLogP | 4.15 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|