C14H9BrN2O4 — CID 684291
N-(4-bromophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine (PubChem CID 684291) has the molecular formula C14H9BrN2O4 and a molecular weight of 349.14 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine.
| Compound Name | N-(4-bromophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
|---|---|
| PubChem CID | 684291 |
| Molecular Formula | C14H9BrN2O4 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | N-(4-bromophenyl)-1-(6-nitro-1,3-benzodioxol-5-yl)methanimine |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N/c1ccc(Br)cc1)OCO2 |
| InChI | InChI=1S/C14H9BrN2O4/c15-10-1-3-11(4-2-10)16-7-9-5-13-14(21-8-20-13)6-12(9)17(18)19/h1-7H,8H2/b16-7+ |
| InChIKey | LXQZMVCAHMKVPG-FRKPEAEDSA-N |
| XLogP | 3.84 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|