C10H7N5O4 — CID 5393185
(Z)-1-(6-nitro-1,3-benzodioxol-5-yl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5393185) has the molecular formula C10H7N5O4 and a molecular weight of 261.20 g/mol. Its IUPAC name is (Z)-1-(6-nitro-1,3-benzodioxol-5-yl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(6-nitro-1,3-benzodioxol-5-yl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5393185 |
| Molecular Formula | C10H7N5O4 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | (Z)-1-(6-nitro-1,3-benzodioxol-5-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=N\n1cnnc1)OCO2 |
| InChI | InChI=1S/C10H7N5O4/c16-15(17)8-2-10-9(18-6-19-10)1-7(8)3-13-14-4-11-12-5-14/h1-5H,6H2/b13-3- |
| InChIKey | XQFKDVFIDIPOAA-DXNYSGJVSA-N |
| XLogP | 0.80 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|