C14H13N5O4 — CID 2848654
4,6-dimethyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-2-amine (PubChem CID 2848654) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 2848654 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4,6-dimethyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NN=Cc2cc3c(cc2[N+](=O)[O-])OCO3)n1 |
| InChI | InChI=1S/C14H13N5O4/c1-8-3-9(2)17-14(16-8)18-15-6-10-4-12-13(23-7-22-12)5-11(10)19(20)21/h3-6H,7H2,1-2H3,(H,16,17,18) |
| InChIKey | WJFAXXAGJKPALS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|