C17H11N7O4 — CID 6813765
N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6813765) has the molecular formula C17H11N7O4 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6813765 |
| Molecular Formula | C17H11N7O4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | O=[N+]([O-])c1cc2c(cc1C=NNc1nnc3c(n1)[nH]c1ccccc13)OCO2 |
| InChI | InChI=1S/C17H11N7O4/c25-24(26)12-6-14-13(27-8-28-14)5-9(12)7-18-22-17-20-16-15(21-23-17)10-3-1-2-4-11(10)19-16/h1-7H,8H2,(H2,19,20,22,23) |
| InChIKey | RIXLIGCUBCRBMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|