C16H10ClN7O2 — CID 6799718
N-[(4-chloro-3-nitrophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6799718) has the molecular formula C16H10ClN7O2 and a molecular weight of 367.76 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6799718 |
| Molecular Formula | C16H10ClN7O2 |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | O=[N+]([O-])c1cc(C=NNc2nnc3c(n2)[nH]c2ccccc23)ccc1Cl |
| InChI | InChI=1S/C16H10ClN7O2/c17-11-6-5-9(7-13(11)24(25)26)8-18-22-16-20-15-14(21-23-16)10-3-1-2-4-12(10)19-15/h1-8H,(H2,19,20,22,23) |
| InChIKey | VZFSMXBTZUSPKV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|