C17H11N6O2- — CID 7290221
4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]benzoate (PubChem CID 7290221) has the molecular formula C17H11N6O2- and a molecular weight of 331.32 g/mol. Its IUPAC name is 4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]benzoate.
| Compound Name | 4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 7290221 |
| Molecular Formula | C17H11N6O2- |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]benzoate |
| SMILES | O=C([O-])c1ccc(/C=N\Nc2nnc3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C17H12N6O2/c24-16(25)11-7-5-10(6-8-11)9-18-22-17-20-15-14(21-23-17)12-3-1-2-4-13(12)19-15/h1-9H,(H,24,25)(H2,19,20,22,23)/p-1/b18-9- |
| InChIKey | CAPPGCUBNONDCY-NVMNQCDNSA-M |
| XLogP | 1.32 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|