C20H16N8O — CID 135998652
5-methyl-2-phenyl-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]-1H-pyrazol-3-one (PubChem CID 135998652) has the molecular formula C20H16N8O and a molecular weight of 384.40 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]-1H-pyrazol-3-one.
| Compound Name | 5-methyl-2-phenyl-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135998652 |
| Molecular Formula | C20H16N8O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-methyl-2-phenyl-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/Nc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C20H16N8O/c1-12-15(19(29)28(27-12)13-7-3-2-4-8-13)11-21-25-20-23-18-17(24-26-20)14-9-5-6-10-16(14)22-18/h2-11,27H,1H3,(H2,22,23,25,26)/b21-11+ |
| InChIKey | VDQWCCVIEKTZTG-SRZZPIQSSA-N |
| XLogP | 2.74 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|