C21H18N8 — CID 6804497
N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6804497) has the molecular formula C21H18N8 and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6804497 |
| Molecular Formula | C21H18N8 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=NNc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C21H18N8/c1-13-17(14(2)29(28-13)15-8-4-3-5-9-15)12-22-26-21-24-20-19(25-27-21)16-10-6-7-11-18(16)23-20/h3-12H,1-2H3,(H2,23,24,26,27) |
| InChIKey | XTZISNDYVREYDS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|