C20H14N12 — CID 6415570
N-[(Z)-[(2Z)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)ethylidene]amino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6415570) has the molecular formula C20H14N12 and a molecular weight of 422.42 g/mol. Its IUPAC name is N-[(Z)-[(2Z)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)ethylidene]amino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-[(2Z)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)ethylidene]amino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6415570 |
| Molecular Formula | C20H14N12 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[(Z)-[(2Z)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)ethylidene]amino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | C(/C=N\Nc1nnc2c(n1)[nH]c1ccccc12)=N/Nc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C20H14N12/c1-3-7-13-11(5-1)15-17(23-13)25-19(31-27-15)29-21-9-10-22-30-20-26-18-16(28-32-20)12-6-2-4-8-14(12)24-18/h1-10H,(H2,23,25,29,31)(H2,24,26,30,32)/b21-9-,22-10- |
| InChIKey | DCNOMOADPNPFCU-KGIZCEIGSA-N |
| XLogP | 2.82 |
| TPSA | 157.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|