C22H20N8O — CID 6823675
1,5-dimethyl-4-[[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-2-phenylpyrazol-3-one (PubChem CID 6823675) has the molecular formula C22H20N8O and a molecular weight of 412.46 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6823675 |
| Molecular Formula | C22H20N8O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1,5-dimethyl-4-[[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1cccc2c1[nH]c1nc(NN=Cc3c(C)n(C)n(-c4ccccc4)c3=O)nnc12 |
| InChI | InChI=1S/C22H20N8O/c1-13-8-7-11-16-18(13)24-20-19(16)26-28-22(25-20)27-23-12-17-14(2)29(3)30(21(17)31)15-9-5-4-6-10-15/h4-12H,1-3H3,(H2,24,25,27,28) |
| InChIKey | XIKFLQKRQKSTOJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|