C17H14N6 — CID 6414497
N-[(Z)-benzylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6414497) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-benzylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6414497 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(Z)-benzylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1cccc2c1[nH]c1nc(N/N=C\c3ccccc3)nnc12 |
| InChI | InChI=1S/C17H14N6/c1-11-6-5-9-13-14(11)19-16-15(13)21-23-17(20-16)22-18-10-12-7-3-2-4-8-12/h2-10H,1H3,(H2,19,20,22,23)/b18-10- |
| InChIKey | GPJPAODGHHGKAV-ZDLGFXPLSA-N |
| XLogP | 3.26 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|