C17H14N6O — CID 135446615
4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135446615) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135446615 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cccc2c1[nH]c1nc(N/N=C\c3ccc(O)cc3)nnc12 |
| InChI | InChI=1S/C17H14N6O/c1-10-3-2-4-13-14(10)19-16-15(13)21-23-17(20-16)22-18-9-11-5-7-12(24)8-6-11/h2-9,24H,1H3,(H2,19,20,22,23)/b18-9- |
| InChIKey | NYCPTUXRMJTEJL-NVMNQCDNSA-N |
| XLogP | 2.97 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|