C19H15N7 — CID 135470795
N-[(Z)-1H-indol-3-ylmethylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 135470795) has the molecular formula C19H15N7 and a molecular weight of 341.38 g/mol. Its IUPAC name is N-[(Z)-1H-indol-3-ylmethylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 135470795 |
| Molecular Formula | C19H15N7 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[(Z)-1H-indol-3-ylmethylideneamino]-6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1cccc2c1[nH]c1nc(N/N=C\c3c[nH]c4ccccc34)nnc12 |
| InChI | InChI=1S/C19H15N7/c1-11-5-4-7-14-16(11)22-18-17(14)24-26-19(23-18)25-21-10-12-9-20-15-8-3-2-6-13(12)15/h2-10,20H,1H3,(H2,22,23,25,26)/b21-10- |
| InChIKey | BTOLSTRXVLRDER-FBHDLOMBSA-N |
| XLogP | 3.74 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|