C18H15BrN6O2 — CID 135446616
2-bromo-6-methoxy-4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135446616) has the molecular formula C18H15BrN6O2 and a molecular weight of 427.26 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135446616 |
| Molecular Formula | C18H15BrN6O2 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(Z)-[(6-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N\Nc2nnc3c(n2)[nH]c2c(C)cccc23)cc(Br)c1O |
| InChI | InChI=1S/C18H15BrN6O2/c1-9-4-3-5-11-14(9)21-17-15(11)23-25-18(22-17)24-20-8-10-6-12(19)16(26)13(7-10)27-2/h3-8,26H,1-2H3,(H2,21,22,24,25)/b20-8- |
| InChIKey | PTUWPKPVHNBGAH-ZBKNUEDVSA-N |
| XLogP | 3.74 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|