C17H13BrN6O2 — CID 135904998
2-bromo-6-methoxy-4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenol (PubChem CID 135904998) has the molecular formula C17H13BrN6O2 and a molecular weight of 413.24 g/mol. Its IUPAC name is 2-bromo-6-methoxy-4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-bromo-6-methoxy-4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135904998 |
| Molecular Formula | C17H13BrN6O2 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-bromo-6-methoxy-4-[(Z)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenol |
| SMILES | COc1cc(/C=N\Nc2nnc3c(n2)[nH]c2ccccc23)cc(Br)c1O |
| InChI | InChI=1S/C17H13BrN6O2/c1-26-13-7-9(6-11(18)15(13)25)8-19-23-17-21-16-14(22-24-17)10-4-2-3-5-12(10)20-16/h2-8,25H,1H3,(H2,20,21,23,24)/b19-8- |
| InChIKey | YZHPJGQCBADWHK-UWVJOHFNSA-N |
| XLogP | 3.43 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|