C17H12Br2N6O — CID 135504322
2,6-dibromo-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135504322) has the molecular formula C17H12Br2N6O and a molecular weight of 476.13 g/mol. Its IUPAC name is 2,6-dibromo-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135504322 |
| Molecular Formula | C17H12Br2N6O |
| Molecular Weight | 476.13 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | 2,6-dibromo-4-[(E)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1ccc2[nH]c3nc(N/N=C/c4cc(Br)c(O)c(Br)c4)nnc3c2c1 |
| InChI | InChI=1S/C17H12Br2N6O/c1-8-2-3-13-10(4-8)14-16(21-13)22-17(25-23-14)24-20-7-9-5-11(18)15(26)12(19)6-9/h2-7,26H,1H3,(H2,21,22,24,25)/b20-7+ |
| InChIKey | CFUUGXWTCIDVAA-IFRROFPPSA-N |
| XLogP | 4.49 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.13 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|