C17H13FN6 — CID 53265203
N-[(E)-(4-fluorophenyl)methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265203) has the molecular formula C17H13FN6 and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[(E)-(4-fluorophenyl)methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(4-fluorophenyl)methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265203 |
| Molecular Formula | C17H13FN6 |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[(E)-(4-fluorophenyl)methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1ccc2[nH]c3nc(N/N=C/c4ccc(F)cc4)nnc3c2c1 |
| InChI | InChI=1S/C17H13FN6/c1-10-2-7-14-13(8-10)15-16(20-14)21-17(24-22-15)23-19-9-11-3-5-12(18)6-4-11/h2-9H,1H3,(H2,20,21,23,24)/b19-9+ |
| InChIKey | GQRDQZSZGQPKRG-DJKKODMXSA-N |
| XLogP | 3.40 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|