C24H20N6O — CID 53265698
8-methyl-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265698) has the molecular formula C24H20N6O and a molecular weight of 408.47 g/mol. Its IUPAC name is 8-methyl-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 8-methyl-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265698 |
| Molecular Formula | C24H20N6O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 8-methyl-N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1ccc2[nH]c3nc(N/N=C/c4cccc(OCc5ccccc5)c4)nnc3c2c1 |
| InChI | InChI=1S/C24H20N6O/c1-16-10-11-21-20(12-16)22-23(26-21)27-24(30-28-22)29-25-14-18-8-5-9-19(13-18)31-15-17-6-3-2-4-7-17/h2-14H,15H2,1H3,(H2,26,27,29,30)/b25-14+ |
| InChIKey | MLANYOPGPVQBAI-AFUMVMLFSA-N |
| XLogP | 4.84 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|