C27H20N6O — CID 6802974
N-[[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6802974) has the molecular formula C27H20N6O and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6802974 |
| Molecular Formula | C27H20N6O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | C(=NNc1nnc2c(n1)[nH]c1ccccc12)c1cccc(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C27H20N6O/c1-2-12-22-19(8-1)9-6-10-20(22)17-34-21-11-5-7-18(15-21)16-28-32-27-30-26-25(31-33-27)23-13-3-4-14-24(23)29-26/h1-16H,17H2,(H2,29,30,32,33) |
| InChIKey | AZLIAMRHSPOJPD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|