C21H15ClN6O — CID 6410097
N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6410097) has the molecular formula C21H15ClN6O and a molecular weight of 402.85 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6410097 |
| Molecular Formula | C21H15ClN6O |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1ccc2[nH]c3nc(N/N=C\c4ccc(-c5ccc(Cl)cc5)o4)nnc3c2c1 |
| InChI | InChI=1S/C21H15ClN6O/c1-12-2-8-17-16(10-12)19-20(24-17)25-21(28-26-19)27-23-11-15-7-9-18(29-15)13-3-5-14(22)6-4-13/h2-11H,1H3,(H2,24,25,27,28)/b23-11- |
| InChIKey | JHLGFFHKRSSRMC-KSEXSDGBSA-N |
| XLogP | 5.17 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|