C17H13N7O3 — CID 135816533
2-[(Z)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135816533) has the molecular formula C17H13N7O3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-[(Z)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(Z)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135816533 |
| Molecular Formula | C17H13N7O3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[(Z)-[(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | Cc1ccc2[nH]c3nc(N/N=C\c4cccc([N+](=O)[O-])c4O)nnc3c2c1 |
| InChI | InChI=1S/C17H13N7O3/c1-9-5-6-12-11(7-9)14-16(19-12)20-17(23-21-14)22-18-8-10-3-2-4-13(15(10)25)24(26)27/h2-8,25H,1H3,(H2,19,20,22,23)/b18-8- |
| InChIKey | RWFDAONLDZXMPT-LSCVHKIXSA-N |
| XLogP | 2.87 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|