C29H26BrN7O5 — CID 19578628
ethyl 4-[[2-[2-bromo-6-ethoxy-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 19578628) has the molecular formula C29H26BrN7O5 and a molecular weight of 632.48 g/mol. Its IUPAC name is ethyl 4-[[2-[2-bromo-6-ethoxy-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-bromo-6-ethoxy-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19578628 |
| Molecular Formula | C29H26BrN7O5 |
| Molecular Weight | 632.48 g/mol |
| Exact Mass | 631.12 |
| IUPAC Name | ethyl 4-[[2-[2-bromo-6-ethoxy-4-[(E)-(5H-[1,2,4]triazino[5,6-b]indol-3-ylhydrazinylidene)methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2c(Br)cc(/C=N/Nc3nnc4c(n3)[nH]c3ccccc34)cc2OCC)cc1 |
| InChI | InChI=1S/C29H26BrN7O5/c1-3-40-23-14-17(15-31-36-29-34-27-25(35-37-29)20-7-5-6-8-22(20)33-27)13-21(30)26(23)42-16-24(38)32-19-11-9-18(10-12-19)28(39)41-4-2/h5-15H,3-4,16H2,1-2H3,(H,32,38)(H2,33,34,36,37)/b31-15+ |
| InChIKey | AQHMQEFFZAUZKC-IBBHUPRXSA-N |
| XLogP | 5.31 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|