C27H27N3O7 — CID 4176500
4-[2-[[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 4176500) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-[2-[[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 4176500 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 4-[2-[[3-ethoxy-4-[2-(4-ethoxycarbonylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NNc3ccc(C(=O)O)cc3)cc2OCC)cc1 |
| InChI | InChI=1S/C27H27N3O7/c1-3-35-24-15-18(16-28-30-22-12-6-19(7-13-22)26(32)33)5-14-23(24)37-17-25(31)29-21-10-8-20(9-11-21)27(34)36-4-2/h5-16,30H,3-4,17H2,1-2H3,(H,29,31)(H,32,33) |
| InChIKey | HGCXQASYYNQUNZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|