C21H25N5O5 — CID 168592108
ethyl 4-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate (PubChem CID 168592108) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 168592108 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 4-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NN=C(N)N)cc2OCC)cc1 |
| InChI | InChI=1S/C21H25N5O5/c1-3-29-18-11-14(12-24-26-21(22)23)5-10-17(18)31-13-19(27)25-16-8-6-15(7-9-16)20(28)30-4-2/h5-12H,3-4,13H2,1-2H3,(H,25,27)(H4,22,23,26) |
| InChIKey | DEIZCWNHVCZNBT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|