C20H23N5O5 — CID 168591929
methyl 2-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate (PubChem CID 168591929) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 168591929 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | methyl 2-[[2-[4-[(diaminomethylidenehydrazinylidene)methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
| SMILES | CCOc1cc(C=NN=C(N)N)ccc1OCC(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C20H23N5O5/c1-3-29-17-10-13(11-23-25-20(21)22)8-9-16(17)30-12-18(26)24-15-7-5-4-6-14(15)19(27)28-2/h4-11H,3,12H2,1-2H3,(H,24,26)(H4,21,22,25) |
| InChIKey | BFFZQKOXDLSKGM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|