C25H24N4O8S — CID 172926527
methyl 2-[[2-[2-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 172926527) has the molecular formula C25H24N4O8S and a molecular weight of 540.55 g/mol. Its IUPAC name is methyl 2-[[2-[2-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 172926527 |
| Molecular Formula | C25H24N4O8S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | methyl 2-[[2-[2-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)ccc1OCC(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C25H24N4O8S/c1-4-36-19-11-15(13-26-29-25-28-23(32)20(38-25)12-22(31)34-2)9-10-18(19)37-14-21(30)27-17-8-6-5-7-16(17)24(33)35-3/h5-13H,4,14H2,1-3H3,(H,27,30)(H,28,29,32)/b20-12+,26-13? |
| InChIKey | YXEATFXYPUIRBS-QRGXSCNXSA-N |
| XLogP | 2.50 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|