C17H19N3O5S — CID 172925356
methyl (2E)-2-[(2Z)-2-[[3-(ethoxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925356) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[3-(ethoxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[3-(ethoxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925356 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[3-(ethoxymethyl)-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOCc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)ccc1OC |
| InChI | InChI=1S/C17H19N3O5S/c1-4-25-10-12-7-11(5-6-13(12)23-2)9-18-20-17-19-16(22)14(26-17)8-15(21)24-3/h5-9H,4,10H2,1-3H3,(H,19,20,22)/b14-8+,18-9? |
| InChIKey | DPBVSLHYTGMKKM-RJZJQNJASA-N |
| XLogP | 1.84 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|