C21H17BrClN3O5S — CID 172925194
methyl (2E)-2-[(2Z)-2-[[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925194) has the molecular formula C21H17BrClN3O5S and a molecular weight of 538.81 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925194 |
| Molecular Formula | C21H17BrClN3O5S |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 536.98 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[3-[(4-bromo-2-chlorophenoxy)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OC)c(COc3ccc(Br)cc3Cl)c2)NC1=O |
| InChI | InChI=1S/C21H17BrClN3O5S/c1-29-16-5-3-12(7-13(16)11-31-17-6-4-14(22)8-15(17)23)10-24-26-21-25-20(28)18(32-21)9-19(27)30-2/h3-10H,11H2,1-2H3,(H,25,26,28)/b18-9+,24-10? |
| InChIKey | VVHXNLZHGQNJDX-CKKDWCHUSA-N |
| XLogP | 4.30 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|