C20H15BrClN3O4S — CID 172926061
methyl (2E)-2-[(2Z)-2-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926061) has the molecular formula C20H15BrClN3O4S and a molecular weight of 508.78 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926061 |
| Molecular Formula | C20H15BrClN3O4S |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 506.97 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(Br)ccc2OCc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C20H15BrClN3O4S/c1-28-18(26)9-17-19(27)24-20(30-17)25-23-10-13-8-14(21)4-7-16(13)29-11-12-2-5-15(22)6-3-12/h2-10H,11H2,1H3,(H,24,25,27)/b17-9+,23-10? |
| InChIKey | OFXPZZVUMGEICB-SLBZYTGRSA-N |
| XLogP | 4.29 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|