C14H11BrClN3O5S — CID 172925832
methyl (2E)-2-[(2Z)-2-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925832) has the molecular formula C14H11BrClN3O5S and a molecular weight of 448.68 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925832 |
| Molecular Formula | C14H11BrClN3O5S |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 446.93 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2-bromo-3-chloro-4-hydroxy-5-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(OC)c(O)c(Cl)c2Br)NC1=O |
| InChI | InChI=1S/C14H11BrClN3O5S/c1-23-7-3-6(10(15)11(16)12(7)21)5-17-19-14-18-13(22)8(25-14)4-9(20)24-2/h3-5,21H,1-2H3,(H,18,19,22)/b8-4+,17-5? |
| InChIKey | PBKUDMGUKKCOEO-QJZOYDJZSA-N |
| XLogP | 2.43 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|