C13H8BrF2N3O4S — CID 172926834
methyl (2E)-2-[(2Z)-2-[(5-bromo-2,3-difluoro-4-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926834) has the molecular formula C13H8BrF2N3O4S and a molecular weight of 420.19 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(5-bromo-2,3-difluoro-4-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(5-bromo-2,3-difluoro-4-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926834 |
| Molecular Formula | C13H8BrF2N3O4S |
| Molecular Weight | 420.19 g/mol |
| Exact Mass | 418.94 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(5-bromo-2,3-difluoro-4-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(Br)c(O)c(F)c2F)NC1=O |
| InChI | InChI=1S/C13H8BrF2N3O4S/c1-23-8(20)3-7-12(22)18-13(24-7)19-17-4-5-2-6(14)11(21)10(16)9(5)15/h2-4,21H,1H3,(H,18,19,22)/b7-3+,17-4? |
| InChIKey | ISGRPTXYEMWOKP-SMLFHXAHSA-N |
| XLogP | 2.04 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|