C14H11F2N3O4S — CID 172925481
methyl (2E)-2-[(2Z)-2-[(3,5-difluoro-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172925481) has the molecular formula C14H11F2N3O4S and a molecular weight of 355.32 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(3,5-difluoro-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(3,5-difluoro-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172925481 |
| Molecular Formula | C14H11F2N3O4S |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(3,5-difluoro-2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(F)cc(F)c2OC)NC1=O |
| InChI | InChI=1S/C14H11F2N3O4S/c1-22-11(20)5-10-13(21)18-14(24-10)19-17-6-7-3-8(15)4-9(16)12(7)23-2/h3-6H,1-2H3,(H,18,19,21)/b10-5+,17-6? |
| InChIKey | FHZRRVLMRCRHGC-LLQAHPNWSA-N |
| XLogP | 1.58 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|