C15H14BrN3O5S — CID 172924395
methyl (2E)-2-[(2Z)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172924395) has the molecular formula C15H14BrN3O5S and a molecular weight of 428.26 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172924395 |
| Molecular Formula | C15H14BrN3O5S |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(OC)c(OC)cc2Br)NC1=O |
| InChI | InChI=1S/C15H14BrN3O5S/c1-22-10-4-8(9(16)5-11(10)23-2)7-17-19-15-18-14(21)12(25-15)6-13(20)24-3/h4-7H,1-3H3,(H,18,19,21)/b12-6+,17-7? |
| InChIKey | JWRFZQWGLCHKSZ-RLSKXXKBSA-N |
| XLogP | 2.08 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|