C13H9Br2N3O3S — CID 172924528
methyl (2E)-2-[(2Z)-2-[(2,6-dibromophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172924528) has the molecular formula C13H9Br2N3O3S and a molecular weight of 447.11 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2,6-dibromophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2,6-dibromophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172924528 |
| Molecular Formula | C13H9Br2N3O3S |
| Molecular Weight | 447.11 g/mol |
| Exact Mass | 444.87 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2,6-dibromophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2c(Br)cccc2Br)NC1=O |
| InChI | InChI=1S/C13H9Br2N3O3S/c1-21-11(19)5-10-12(20)17-13(22-10)18-16-6-7-8(14)3-2-4-9(7)15/h2-6H,1H3,(H,17,18,20)/b10-5+,16-6? |
| InChIKey | QULYEIAQBFRZHU-UKLIJEGDSA-N |
| XLogP | 2.82 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|