C14H12BrN3O3S2 — CID 172926697
methyl (2E)-2-[(2Z)-2-[(3-bromo-4-methylsulfanylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926697) has the molecular formula C14H12BrN3O3S2 and a molecular weight of 414.31 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(3-bromo-4-methylsulfanylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(3-bromo-4-methylsulfanylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926697 |
| Molecular Formula | C14H12BrN3O3S2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(3-bromo-4-methylsulfanylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(SC)c(Br)c2)NC1=O |
| InChI | InChI=1S/C14H12BrN3O3S2/c1-21-12(19)6-11-13(20)17-14(23-11)18-16-7-8-3-4-10(22-2)9(15)5-8/h3-7H,1-2H3,(H,17,18,20)/b11-6+,16-7? |
| InChIKey | TVXFTJHIHWTKNY-DFUWENOTSA-N |
| XLogP | 2.78 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|