C15H13F2N3O4S — CID 172926542
methyl (2E)-2-[(2Z)-2-[[4-(2,2-difluoroethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926542) has the molecular formula C15H13F2N3O4S and a molecular weight of 369.35 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-(2,2-difluoroethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-(2,2-difluoroethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926542 |
| Molecular Formula | C15H13F2N3O4S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-(2,2-difluoroethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OCC(F)F)cc2)NC1=O |
| InChI | InChI=1S/C15H13F2N3O4S/c1-23-13(21)6-11-14(22)19-15(25-11)20-18-7-9-2-4-10(5-3-9)24-8-12(16)17/h2-7,12H,8H2,1H3,(H,19,20,22)/b11-6+,18-7? |
| InChIKey | RUXVWMDUHGDLOA-WIZQOCLFSA-N |
| XLogP | 1.94 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|