C21H27N5O4S — CID 172926029
methyl (2E)-2-[(2Z)-2-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926029) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926029 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCN1CCN(CCOc2ccc(C=N/N=C3/NC(=O)/C(=C\C(=O)OC)S3)cc2)CC1 |
| InChI | InChI=1S/C21H27N5O4S/c1-3-25-8-10-26(11-9-25)12-13-30-17-6-4-16(5-7-17)15-22-24-21-23-20(28)18(31-21)14-19(27)29-2/h4-7,14-15H,3,8-13H2,1-2H3,(H,23,24,28)/b18-14+,22-15? |
| InChIKey | YMVICJIEWUWTSF-AZORJWNQSA-N |
| XLogP | 1.31 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|