C20H15N5O4S2 — CID 172926985
methyl (2E)-2-[(2Z)-2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926985) has the molecular formula C20H15N5O4S2 and a molecular weight of 453.51 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926985 |
| Molecular Formula | C20H15N5O4S2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OCc3ccc4nsnc4c3)cc2)NC1=O |
| InChI | InChI=1S/C20H15N5O4S2/c1-28-18(26)9-17-19(27)22-20(30-17)23-21-10-12-2-5-14(6-3-12)29-11-13-4-7-15-16(8-13)25-31-24-15/h2-10H,11H2,1H3,(H,22,23,27)/b17-9+,21-10? |
| InChIKey | YROLBXRADNSAJS-XMJFUWNOSA-N |
| XLogP | 2.88 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|