C13H11BFN3O5S — CID 172924507
[3-fluoro-2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 172924507) has the molecular formula C13H11BFN3O5S and a molecular weight of 351.12 g/mol. Its IUPAC name is [3-fluoro-2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 172924507 |
| Molecular Formula | C13H11BFN3O5S |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [3-fluoro-2-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2c(F)cccc2B(O)O)NC1=O |
| InChI | InChI=1S/C13H11BFN3O5S/c1-23-11(19)5-10-12(20)17-13(24-10)18-16-6-7-8(14(21)22)3-2-4-9(7)15/h2-6,21-22H,1H3,(H,17,18,20)/b10-5+,16-6? |
| InChIKey | MIXTZOPZOYXFPX-UKLIJEGDSA-N |
| XLogP | -0.88 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|