C14H10FN3O5S — CID 172927218
2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid (PubChem CID 172927218) has the molecular formula C14H10FN3O5S and a molecular weight of 351.32 g/mol. Its IUPAC name is 2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 172927218 |
| Molecular Formula | C14H10FN3O5S |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cccc(F)c2C(=O)O)NC1=O |
| InChI | InChI=1S/C14H10FN3O5S/c1-23-10(19)5-9-12(20)17-14(24-9)18-16-6-7-3-2-4-8(15)11(7)13(21)22/h2-6H,1H3,(H,21,22)(H,17,18,20)/b9-5+,16-6? |
| InChIKey | WNJXOPCGVUYCQB-MMALZZSJSA-N |
| XLogP | 1.13 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|