C21H16FN3O6S — CID 172925631
methyl 4-fluoro-3-[2-hydroxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]benzoate (PubChem CID 172925631) has the molecular formula C21H16FN3O6S and a molecular weight of 457.44 g/mol. Its IUPAC name is methyl 4-fluoro-3-[2-hydroxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]benzoate.
| Compound Name | methyl 4-fluoro-3-[2-hydroxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 172925631 |
| Molecular Formula | C21H16FN3O6S |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | methyl 4-fluoro-3-[2-hydroxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]benzoate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cccc(-c3cc(C(=O)OC)ccc3F)c2O)NC1=O |
| InChI | InChI=1S/C21H16FN3O6S/c1-30-17(26)9-16-19(28)24-21(32-16)25-23-10-12-4-3-5-13(18(12)27)14-8-11(20(29)31-2)6-7-15(14)22/h3-10,27H,1-2H3,(H,24,25,28)/b16-9+,23-10? |
| InChIKey | VEILGXBXEZLJFM-JRYOGKSWSA-N |
| XLogP | 2.59 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|