C15H9F4N3O5S — CID 172927145
methyl (2E)-2-[(2Z)-4-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172927145) has the molecular formula C15H9F4N3O5S and a molecular weight of 419.31 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-4-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-4-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172927145 |
| Molecular Formula | C15H9F4N3O5S |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | methyl (2E)-2-[(2Z)-4-oxo-2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)methylidenehydrazinylidene]-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cccc3c2OC(F)(F)C(F)(F)O3)NC1=O |
| InChI | InChI=1S/C15H9F4N3O5S/c1-25-10(23)5-9-12(24)21-13(28-9)22-20-6-7-3-2-4-8-11(7)27-15(18,19)14(16,17)26-8/h2-6H,1H3,(H,21,22,24)/b9-5+,20-6? |
| InChIKey | XEQPJXOEBGUKFU-FJWPIAKTSA-N |
| XLogP | 2.25 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|