C17H17Br2N3O5S — CID 172926413
methyl (2E)-2-[(2Z)-2-[(2,3-dibromo-4,5-diethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926413) has the molecular formula C17H17Br2N3O5S and a molecular weight of 535.21 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(2,3-dibromo-4,5-diethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(2,3-dibromo-4,5-diethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926413 |
| Molecular Formula | C17H17Br2N3O5S |
| Molecular Weight | 535.21 g/mol |
| Exact Mass | 532.93 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(2,3-dibromo-4,5-diethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)c(Br)c(Br)c1OCC |
| InChI | InChI=1S/C17H17Br2N3O5S/c1-4-26-10-6-9(13(18)14(19)15(10)27-5-2)8-20-22-17-21-16(24)11(28-17)7-12(23)25-3/h6-8H,4-5H2,1-3H3,(H,21,22,24)/b11-7+,20-8? |
| InChIKey | CNLSARXWULDQLX-SCESDABTSA-N |
| XLogP | 3.62 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|