C17H14Br2N4O5S — CID 172926538
methyl (2E)-2-[(2Z)-2-[[2,3-dibromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926538) has the molecular formula C17H14Br2N4O5S and a molecular weight of 546.20 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[2,3-dibromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[2,3-dibromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926538 |
| Molecular Formula | C17H14Br2N4O5S |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 543.91 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[2,3-dibromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)c(Br)c(Br)c1OCC#N |
| InChI | InChI=1S/C17H14Br2N4O5S/c1-3-27-10-6-9(13(18)14(19)15(10)28-5-4-20)8-21-23-17-22-16(25)11(29-17)7-12(24)26-2/h6-8H,3,5H2,1-2H3,(H,22,23,25)/b11-7+,21-8? |
| InChIKey | IRMQEBGNUOHZKB-XLDFUKHZSA-N |
| XLogP | 3.12 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|