C20H22BrN3O5S — CID 172926492
methyl (2E)-2-[(2Z)-2-[(3-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926492) has the molecular formula C20H22BrN3O5S and a molecular weight of 496.38 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(3-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(3-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926492 |
| Molecular Formula | C20H22BrN3O5S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(3-bromo-4-cyclopentyloxy-5-ethoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCOc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)cc(Br)c1OC1CCCC1 |
| InChI | InChI=1S/C20H22BrN3O5S/c1-3-28-15-9-12(8-14(21)18(15)29-13-6-4-5-7-13)11-22-24-20-23-19(26)16(30-20)10-17(25)27-2/h8-11,13H,3-7H2,1-2H3,(H,23,24,26)/b16-10+,22-11? |
| InChIKey | IGSXBOYAYXCVSV-DBBYTEAZSA-N |
| XLogP | 3.78 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|