C15H16BN3O7S — CID 172926919
[2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 172926919) has the molecular formula C15H16BN3O7S and a molecular weight of 393.19 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 172926919 |
| Molecular Formula | C15H16BN3O7S |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(OC)c(B(O)O)c(OC)c2)NC1=O |
| InChI | InChI=1S/C15H16BN3O7S/c1-24-9-4-8(5-10(25-2)13(9)16(22)23)7-17-19-15-18-14(21)11(27-15)6-12(20)26-3/h4-7,22-23H,1-3H3,(H,18,19,21)/b11-6+,17-7? |
| InChIKey | ZRAMLFPTRJVRQB-SOTPDSAOSA-N |
| XLogP | -1.01 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|