C18H19N3O8S — CID 172925853
2-[2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoic acid (PubChem CID 172925853) has the molecular formula C18H19N3O8S and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 172925853 |
| Molecular Formula | C18H19N3O8S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[2,6-dimethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(OC)c(OC(C)C(=O)O)c(OC)c2)NC1=O |
| InChI | InChI=1S/C18H19N3O8S/c1-9(17(24)25)29-15-11(26-2)5-10(6-12(15)27-3)8-19-21-18-20-16(23)13(30-18)7-14(22)28-4/h5-9H,1-4H3,(H,24,25)(H,20,21,23)/b13-7+,19-8? |
| InChIKey | ABZVJHTYLXHCPS-YUETYWHYSA-N |
| XLogP | 1.17 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|